C27H26N6O5S — CID 3621051
N,N,4-trimethyl-2-[3-(4-nitrophenyl)-7-[(4-nitrophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-1,3-thiazole-5-carboxamide (PubChem CID 3621051) has the molecular formula C27H26N6O5S and a molecular weight of 546.61 g/mol. Its IUPAC name is N,N,4-trimethyl-2-[3-(4-nitrophenyl)-7-[(4-nitrophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-1,3-thiazole-5-carboxamide.
| Compound Name | N,N,4-trimethyl-2-[3-(4-nitrophenyl)-7-[(4-nitrophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 3621051 |
| Molecular Formula | C27H26N6O5S |
| Molecular Weight | 546.61 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | N,N,4-trimethyl-2-[3-(4-nitrophenyl)-7-[(4-nitrophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(N2N=C3C(=Cc4ccc([N+](=O)[O-])cc4)CCCC3C2c2ccc([N+](=O)[O-])cc2)sc1C(=O)N(C)C |
| InChI | InChI=1S/C27H26N6O5S/c1-16-25(26(34)30(2)3)39-27(28-16)31-24(18-9-13-21(14-10-18)33(37)38)22-6-4-5-19(23(22)29-31)15-17-7-11-20(12-8-17)32(35)36/h7-15,22,24H,4-6H2,1-3H3 |
| InChIKey | JIZPWIYFMBPMGA-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 135.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.61 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|