C35H27N5O4S — CID 3611813
2-[3-(4-nitrophenyl)-7-[(4-nitrophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-4-(4-phenylphenyl)-1,3-thiazole (PubChem CID 3611813) has the molecular formula C35H27N5O4S and a molecular weight of 613.70 g/mol. Its IUPAC name is 2-[3-(4-nitrophenyl)-7-[(4-nitrophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-4-(4-phenylphenyl)-1,3-thiazole.
| Compound Name | 2-[3-(4-nitrophenyl)-7-[(4-nitrophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-4-(4-phenylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 3611813 |
| Molecular Formula | C35H27N5O4S |
| Molecular Weight | 613.70 g/mol |
| Exact Mass | 613.18 |
| IUPAC Name | 2-[3-(4-nitrophenyl)-7-[(4-nitrophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-4-(4-phenylphenyl)-1,3-thiazole |
| SMILES | O=[N+]([O-])c1ccc(C=C2CCCC3C2=NN(c2nc(-c4ccc(-c5ccccc5)cc4)cs2)C3c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C35H27N5O4S/c41-39(42)29-17-9-23(10-18-29)21-28-7-4-8-31-33(28)37-38(34(31)27-15-19-30(20-16-27)40(43)44)35-36-32(22-45-35)26-13-11-25(12-14-26)24-5-2-1-3-6-24/h1-3,5-6,9-22,31,34H,4,7-8H2 |
| InChIKey | NRERLGVASAWBHW-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 114.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.70 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|