C26H21N5O6 — CID 98370180
(3S,3aS,7Z)-2,3-bis(4-nitrophenyl)-7-[(4-nitrophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazole (PubChem CID 98370180) has the molecular formula C26H21N5O6 and a molecular weight of 499.48 g/mol. Its IUPAC name is (3S,3aS,7Z)-2,3-bis(4-nitrophenyl)-7-[(4-nitrophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazole.
| Compound Name | (3S,3aS,7Z)-2,3-bis(4-nitrophenyl)-7-[(4-nitrophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazole |
|---|---|
| PubChem CID | 98370180 |
| Molecular Formula | C26H21N5O6 |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | (3S,3aS,7Z)-2,3-bis(4-nitrophenyl)-7-[(4-nitrophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazole |
| SMILES | O=[N+]([O-])c1ccc(/C=C2/CCC[C@@H]3C2=NN(c2ccc([N+](=O)[O-])cc2)[C@@H]3c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C26H21N5O6/c32-29(33)21-8-4-17(5-9-21)16-19-2-1-3-24-25(19)27-28(20-12-14-23(15-13-20)31(36)37)26(24)18-6-10-22(11-7-18)30(34)35/h4-16,24,26H,1-3H2/b19-16-/t24-,26-/m1/s1 |
| InChIKey | MAIAMEYAADCASK-MXXWSYFGSA-N |
| XLogP | 6.21 |
| TPSA | 145.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|