C26H25N4O2+ — CID 46859236
(7Z)-7-benzylidene-5-methyl-2-(4-nitrophenyl)-3-phenyl-3a,4,5,6-tetrahydro-3H-pyrazolo[4,3-c]pyridin-5-ium (PubChem CID 46859236) has the molecular formula C26H25N4O2+ and a molecular weight of 425.51 g/mol. Its IUPAC name is (7Z)-7-benzylidene-5-methyl-2-(4-nitrophenyl)-3-phenyl-3a,4,5,6-tetrahydro-3H-pyrazolo[4,3-c]pyridin-5-ium.
| Compound Name | (7Z)-7-benzylidene-5-methyl-2-(4-nitrophenyl)-3-phenyl-3a,4,5,6-tetrahydro-3H-pyrazolo[4,3-c]pyridin-5-ium |
|---|---|
| PubChem CID | 46859236 |
| Molecular Formula | C26H25N4O2+ |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | (7Z)-7-benzylidene-5-methyl-2-(4-nitrophenyl)-3-phenyl-3a,4,5,6-tetrahydro-3H-pyrazolo[4,3-c]pyridin-5-ium |
| SMILES | C[NH+]1C/C(=C/c2ccccc2)C2=NN(c3ccc([N+](=O)[O-])cc3)C(c3ccccc3)C2C1 |
| InChI | InChI=1S/C26H24N4O2/c1-28-17-21(16-19-8-4-2-5-9-19)25-24(18-28)26(20-10-6-3-7-11-20)29(27-25)22-12-14-23(15-13-22)30(31)32/h2-16,24,26H,17-18H2,1H3/p+1/b21-16- |
| InChIKey | NHEVDTXSNBOERE-PGMHBOJBSA-O |
| XLogP | 3.74 |
| TPSA | 63.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|