C28H23N5O4 — CID 55402904
1-[2-[(7E)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl]-5-nitro-2-oxopyridine-3-carbonitrile (PubChem CID 55402904) has the molecular formula C28H23N5O4 and a molecular weight of 493.52 g/mol. Its IUPAC name is 1-[2-[(7E)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl]-5-nitro-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-[2-[(7E)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl]-5-nitro-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 55402904 |
| Molecular Formula | C28H23N5O4 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 1-[2-[(7E)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl]-5-nitro-2-oxopyridine-3-carbonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])cn(CC(=O)N2N=C3/C(=C/c4ccccc4)CCCC3C2c2ccccc2)c1=O |
| InChI | InChI=1S/C28H23N5O4/c29-16-22-15-23(33(36)37)17-31(28(22)35)18-25(34)32-27(20-10-5-2-6-11-20)24-13-7-12-21(26(24)30-32)14-19-8-3-1-4-9-19/h1-6,8-11,14-15,17,24,27H,7,12-13,18H2/b21-14+ |
| InChIKey | BDSNJTDBNJQSNN-KGENOOAVSA-N |
| XLogP | 4.45 |
| TPSA | 121.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|