C20H20N2O2S — CID 1308221
(4S)-4-(2,3-dimethoxyphenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazoline-2-thione (PubChem CID 1308221) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is (4S)-4-(2,3-dimethoxyphenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazoline-2-thione.
| Compound Name | (4S)-4-(2,3-dimethoxyphenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazoline-2-thione |
|---|---|
| PubChem CID | 1308221 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | (4S)-4-(2,3-dimethoxyphenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazoline-2-thione |
| SMILES | COc1cccc([C@H]2NC(=S)NC3=C2CCc2ccccc23)c1OC |
| InChI | InChI=1S/C20H20N2O2S/c1-23-16-9-5-8-15(19(16)24-2)18-14-11-10-12-6-3-4-7-13(12)17(14)21-20(25)22-18/h3-9,18H,10-11H2,1-2H3,(H2,21,22,25)/t18-/m0/s1 |
| InChIKey | RPHOKXJCTWZARJ-SFHVURJKSA-N |
| XLogP | 3.58 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|