C22H24N2OS — CID 2721820
(4R)-4-(4-butoxyphenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazoline-2-thione (PubChem CID 2721820) has the molecular formula C22H24N2OS and a molecular weight of 364.51 g/mol. Its IUPAC name is (4R)-4-(4-butoxyphenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazoline-2-thione.
| Compound Name | (4R)-4-(4-butoxyphenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazoline-2-thione |
|---|---|
| PubChem CID | 2721820 |
| Molecular Formula | C22H24N2OS |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | (4R)-4-(4-butoxyphenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazoline-2-thione |
| SMILES | CCCCOc1ccc([C@H]2NC(=S)NC3=C2CCc2ccccc23)cc1 |
| InChI | InChI=1S/C22H24N2OS/c1-2-3-14-25-17-11-8-16(9-12-17)20-19-13-10-15-6-4-5-7-18(15)21(19)24-22(26)23-20/h4-9,11-12,20H,2-3,10,13-14H2,1H3,(H2,23,24,26)/t20-/m1/s1 |
| InChIKey | YBLQMVGOPFIXLJ-HXUWFJFHSA-N |
| XLogP | 4.74 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|