C31H36N4O3 — CID 67716218
3-[2-[[(1S)-3-[benzyl(methyl)amino]-3-oxo-1-phenylpropyl]amino]ethylamino]-4-(1H-indol-3-yl)butanoic acid (PubChem CID 67716218) has the molecular formula C31H36N4O3 and a molecular weight of 512.65 g/mol. Its IUPAC name is 3-[2-[[(1S)-3-[benzyl(methyl)amino]-3-oxo-1-phenylpropyl]amino]ethylamino]-4-(1H-indol-3-yl)butanoic acid.
| Compound Name | 3-[2-[[(1S)-3-[benzyl(methyl)amino]-3-oxo-1-phenylpropyl]amino]ethylamino]-4-(1H-indol-3-yl)butanoic acid |
|---|---|
| PubChem CID | 67716218 |
| Molecular Formula | C31H36N4O3 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | 3-[2-[[(1S)-3-[benzyl(methyl)amino]-3-oxo-1-phenylpropyl]amino]ethylamino]-4-(1H-indol-3-yl)butanoic acid |
| SMILES | CN(Cc1ccccc1)C(=O)C[C@H](NCCNC(CC(=O)O)Cc1c[nH]c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C31H36N4O3/c1-35(22-23-10-4-2-5-11-23)30(36)20-29(24-12-6-3-7-13-24)33-17-16-32-26(19-31(37)38)18-25-21-34-28-15-9-8-14-27(25)28/h2-15,21,26,29,32-34H,16-20,22H2,1H3,(H,37,38)/t26?,29-/m0/s1 |
| InChIKey | FCEBSSXJLKDIIF-BTMGADRYSA-N |
| XLogP | 4.52 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|