C18H16FN3O4S — CID 67719792
(6R,7R)-7-amino-3-[[1-(2-fluorophenyl)-2-oxopyrrolidin-3-ylidene]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 67719792) has the molecular formula C18H16FN3O4S and a molecular weight of 389.41 g/mol. Its IUPAC name is (6R,7R)-7-amino-3-[[1-(2-fluorophenyl)-2-oxopyrrolidin-3-ylidene]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-7-amino-3-[[1-(2-fluorophenyl)-2-oxopyrrolidin-3-ylidene]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 67719792 |
| Molecular Formula | C18H16FN3O4S |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | (6R,7R)-7-amino-3-[[1-(2-fluorophenyl)-2-oxopyrrolidin-3-ylidene]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | N[C@@H]1C(=O)N2C(C(=O)O)=C(C=C3CCN(c4ccccc4F)C3=O)CS[C@H]12 |
| InChI | InChI=1S/C18H16FN3O4S/c19-11-3-1-2-4-12(11)21-6-5-9(15(21)23)7-10-8-27-17-13(20)16(24)22(17)14(10)18(25)26/h1-4,7,13,17H,5-6,8,20H2,(H,25,26)/t13-,17-/m1/s1 |
| InChIKey | MWGZCLVWXCJQAN-CXAGYDPISA-N |
| XLogP | 1.07 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|