C20H18F3N3O8S — CID 67720168
(6R,7R)-7-amino-3-[(E)-[1-(3,4-dihydroxyphenyl)-2-oxopyrrolidin-3-ylidene]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 67720168) has the molecular formula C20H18F3N3O8S and a molecular weight of 517.44 g/mol. Its IUPAC name is (6R,7R)-7-amino-3-[(E)-[1-(3,4-dihydroxyphenyl)-2-oxopyrrolidin-3-ylidene]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (6R,7R)-7-amino-3-[(E)-[1-(3,4-dihydroxyphenyl)-2-oxopyrrolidin-3-ylidene]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67720168 |
| Molecular Formula | C20H18F3N3O8S |
| Molecular Weight | 517.44 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | (6R,7R)-7-amino-3-[(E)-[1-(3,4-dihydroxyphenyl)-2-oxopyrrolidin-3-ylidene]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | N[C@@H]1C(=O)N2C(C(=O)O)=C(/C=C3\CCN(c4ccc(O)c(O)c4)C3=O)CS[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H17N3O6S.C2HF3O2/c19-13-16(25)21-14(18(26)27)9(7-28-17(13)21)5-8-3-4-20(15(8)24)10-1-2-11(22)12(23)6-10;3-2(4,5)1(6)7/h1-2,5-6,13,17,22-23H,3-4,7,19H2,(H,26,27);(H,6,7)/b8-5+;/t13-,17-;/m1./s1 |
| InChIKey | AWXQOQGKRQYONT-XCHHMPSOSA-N |
| XLogP | 0.98 |
| TPSA | 181.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.44 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|