C23H30O10 — CID 67721650
tetraethyl 2-[4-(2-oxopropoxy)phenyl]ethane-1,1,1,2-tetracarboxylate (PubChem CID 67721650) has the molecular formula C23H30O10 and a molecular weight of 466.48 g/mol. Its IUPAC name is tetraethyl 2-[4-(2-oxopropoxy)phenyl]ethane-1,1,1,2-tetracarboxylate.
| Compound Name | tetraethyl 2-[4-(2-oxopropoxy)phenyl]ethane-1,1,1,2-tetracarboxylate |
|---|---|
| PubChem CID | 67721650 |
| Molecular Formula | C23H30O10 |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | tetraethyl 2-[4-(2-oxopropoxy)phenyl]ethane-1,1,1,2-tetracarboxylate |
| SMILES | CCOC(=O)C(c1ccc(OCC(C)=O)cc1)C(C(=O)OCC)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C23H30O10/c1-6-29-19(25)18(16-10-12-17(13-11-16)33-14-15(5)24)23(20(26)30-7-2,21(27)31-8-3)22(28)32-9-4/h10-13,18H,6-9,14H2,1-5H3 |
| InChIKey | AYRDYZAHRLYQNP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|