C24H27ClN4O3 — CID 67722272
N-butyl-2-[3-[[5-(4-chlorobenzoyl)-1,4-dimethylpyrrol-2-yl]methyl]-6-oxopyridazin-1-yl]acetamide (PubChem CID 67722272) has the molecular formula C24H27ClN4O3 and a molecular weight of 454.96 g/mol. Its IUPAC name is N-butyl-2-[3-[[5-(4-chlorobenzoyl)-1,4-dimethylpyrrol-2-yl]methyl]-6-oxopyridazin-1-yl]acetamide.
| Compound Name | N-butyl-2-[3-[[5-(4-chlorobenzoyl)-1,4-dimethylpyrrol-2-yl]methyl]-6-oxopyridazin-1-yl]acetamide |
|---|---|
| PubChem CID | 67722272 |
| Molecular Formula | C24H27ClN4O3 |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | N-butyl-2-[3-[[5-(4-chlorobenzoyl)-1,4-dimethylpyrrol-2-yl]methyl]-6-oxopyridazin-1-yl]acetamide |
| SMILES | CCCCNC(=O)Cn1nc(Cc2cc(C)c(C(=O)c3ccc(Cl)cc3)n2C)ccc1=O |
| InChI | InChI=1S/C24H27ClN4O3/c1-4-5-12-26-21(30)15-29-22(31)11-10-19(27-29)14-20-13-16(2)23(28(20)3)24(32)17-6-8-18(25)9-7-17/h6-11,13H,4-5,12,14-15H2,1-3H3,(H,26,30) |
| InChIKey | CXSARICNCAMBAN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|