C20H19Cl2N3O2 — CID 67722309
6-[[5-(4-chlorobenzoyl)-1,4-dimethylpyrrol-2-yl]methyl]-2-(2-chloroethyl)pyridazin-3-one (PubChem CID 67722309) has the molecular formula C20H19Cl2N3O2 and a molecular weight of 404.30 g/mol. Its IUPAC name is 6-[[5-(4-chlorobenzoyl)-1,4-dimethylpyrrol-2-yl]methyl]-2-(2-chloroethyl)pyridazin-3-one.
| Compound Name | 6-[[5-(4-chlorobenzoyl)-1,4-dimethylpyrrol-2-yl]methyl]-2-(2-chloroethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 67722309 |
| Molecular Formula | C20H19Cl2N3O2 |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 6-[[5-(4-chlorobenzoyl)-1,4-dimethylpyrrol-2-yl]methyl]-2-(2-chloroethyl)pyridazin-3-one |
| SMILES | Cc1cc(Cc2ccc(=O)n(CCCl)n2)n(C)c1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19Cl2N3O2/c1-13-11-17(12-16-7-8-18(26)25(23-16)10-9-21)24(2)19(13)20(27)14-3-5-15(22)6-4-14/h3-8,11H,9-10,12H2,1-2H3 |
| InChIKey | MBBGVVMYBTXNPU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|