C14H12N2O4 — CID 67724723
4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]isoindole-1,3-dione (PubChem CID 67724723) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]isoindole-1,3-dione.
| Compound Name | 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67724723 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]isoindole-1,3-dione |
| SMILES | Cc1noc(C)c1COc1cccc2c1C(=O)NC2=O |
| InChI | InChI=1S/C14H12N2O4/c1-7-10(8(2)20-16-7)6-19-11-5-3-4-9-12(11)14(18)15-13(9)17/h3-5H,6H2,1-2H3,(H,15,17,18) |
| InChIKey | WTPVLHYMDFMHDL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|