C23H31N3O6 — CID 67725043
(6aR,10aR)-7-butyl-N-(methoxymethyl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide;oxalic acid (PubChem CID 67725043) has the molecular formula C23H31N3O6 and a molecular weight of 445.52 g/mol. Its IUPAC name is (6aR,10aR)-7-butyl-N-(methoxymethyl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide;oxalic acid.
| Compound Name | (6aR,10aR)-7-butyl-N-(methoxymethyl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 67725043 |
| Molecular Formula | C23H31N3O6 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | (6aR,10aR)-7-butyl-N-(methoxymethyl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide;oxalic acid |
| SMILES | CCCCN1CC(C(=O)NCOC)C[C@@H]2c3cccc4[nH]cc(c34)C[C@H]21.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H29N3O2.C2H2O4/c1-3-4-8-24-12-15(21(25)23-13-26-2)9-17-16-6-5-7-18-20(16)14(11-22-18)10-19(17)24;3-1(4)2(5)6/h5-7,11,15,17,19,22H,3-4,8-10,12-13H2,1-2H3,(H,23,25);(H,3,4)(H,5,6)/t15?,17-,19-;/m1./s1 |
| InChIKey | HWQNBJKULJOFGS-WBVZIVLISA-N |
| XLogP | 2.17 |
| TPSA | 131.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|