C14H18FNO — CID 67725215
(1S)-1-[(3S)-3-fluoropyrrolidin-1-yl]-1-phenylbutan-2-one (PubChem CID 67725215) has the molecular formula C14H18FNO and a molecular weight of 235.30 g/mol. Its IUPAC name is (1S)-1-[(3S)-3-fluoropyrrolidin-1-yl]-1-phenylbutan-2-one.
| Compound Name | (1S)-1-[(3S)-3-fluoropyrrolidin-1-yl]-1-phenylbutan-2-one |
|---|---|
| PubChem CID | 67725215 |
| Molecular Formula | C14H18FNO |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | (1S)-1-[(3S)-3-fluoropyrrolidin-1-yl]-1-phenylbutan-2-one |
| SMILES | CCC(=O)[C@H](c1ccccc1)N1CC[C@H](F)C1 |
| InChI | InChI=1S/C14H18FNO/c1-2-13(17)14(11-6-4-3-5-7-11)16-9-8-12(15)10-16/h3-7,12,14H,2,8-10H2,1H3/t12-,14-/m0/s1 |
| InChIKey | QVJWRCKMZZVXKE-JSGCOSHPSA-N |
| XLogP | 2.75 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |