C19H20ClFN4O4 — CID 67726419
[N'-[(4-chloro-2-fluoro-5-phenylmethoxyphenyl)carbamoyl]-N,N-dimethylcarbamimidoyl]-methylcarbamic acid (PubChem CID 67726419) has the molecular formula C19H20ClFN4O4 and a molecular weight of 422.84 g/mol. Its IUPAC name is [N'-[(4-chloro-2-fluoro-5-phenylmethoxyphenyl)carbamoyl]-N,N-dimethylcarbamimidoyl]-methylcarbamic acid.
| Compound Name | [N'-[(4-chloro-2-fluoro-5-phenylmethoxyphenyl)carbamoyl]-N,N-dimethylcarbamimidoyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 67726419 |
| Molecular Formula | C19H20ClFN4O4 |
| Molecular Weight | 422.84 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | [N'-[(4-chloro-2-fluoro-5-phenylmethoxyphenyl)carbamoyl]-N,N-dimethylcarbamimidoyl]-methylcarbamic acid |
| SMILES | CN(C)C(=NC(=O)Nc1cc(OCc2ccccc2)c(Cl)cc1F)N(C)C(=O)O |
| InChI | InChI=1S/C19H20ClFN4O4/c1-24(2)18(25(3)19(27)28)23-17(26)22-15-10-16(13(20)9-14(15)21)29-11-12-7-5-4-6-8-12/h4-10H,11H2,1-3H3,(H,22,26)(H,27,28) |
| InChIKey | SJUIEBDBPIBDEV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.84 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|