C20H16ClN2NaO4 — CID 67727271
sodium 2-[3-(2-amino-2-oxoethyl)-1-[(3-chlorophenyl)methyl]-2-methylindol-4-yl]-2-oxoacetate (PubChem CID 67727271) has the molecular formula C20H16ClN2NaO4 and a molecular weight of 406.80 g/mol. Its IUPAC name is sodium 2-[3-(2-amino-2-oxoethyl)-1-[(3-chlorophenyl)methyl]-2-methylindol-4-yl]-2-oxoacetate.
| Compound Name | sodium 2-[3-(2-amino-2-oxoethyl)-1-[(3-chlorophenyl)methyl]-2-methylindol-4-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 67727271 |
| Molecular Formula | C20H16ClN2NaO4 |
| Molecular Weight | 406.80 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | sodium 2-[3-(2-amino-2-oxoethyl)-1-[(3-chlorophenyl)methyl]-2-methylindol-4-yl]-2-oxoacetate |
| SMILES | Cc1c(CC(N)=O)c2c(C(=O)C(=O)[O-])cccc2n1Cc1cccc(Cl)c1.[Na+] |
| InChI | InChI=1S/C20H17ClN2O4.Na/c1-11-15(9-17(22)24)18-14(19(25)20(26)27)6-3-7-16(18)23(11)10-12-4-2-5-13(21)8-12;/h2-8H,9-10H2,1H3,(H2,22,24)(H,26,27);/q;+1/p-1 |
| InChIKey | ZAUYWKCGNUYLJH-UHFFFAOYSA-M |
| XLogP | -1.38 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.80 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|