C21H24Cl2N2O2 — CID 67733334
ethyl 4-[1,2-bis(2-chlorophenyl)ethyl]piperazine-2-carboxylate (PubChem CID 67733334) has the molecular formula C21H24Cl2N2O2 and a molecular weight of 407.34 g/mol. Its IUPAC name is ethyl 4-[1,2-bis(2-chlorophenyl)ethyl]piperazine-2-carboxylate.
| Compound Name | ethyl 4-[1,2-bis(2-chlorophenyl)ethyl]piperazine-2-carboxylate |
|---|---|
| PubChem CID | 67733334 |
| Molecular Formula | C21H24Cl2N2O2 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | ethyl 4-[1,2-bis(2-chlorophenyl)ethyl]piperazine-2-carboxylate |
| SMILES | CCOC(=O)C1CN(C(Cc2ccccc2Cl)c2ccccc2Cl)CCN1 |
| InChI | InChI=1S/C21H24Cl2N2O2/c1-2-27-21(26)19-14-25(12-11-24-19)20(16-8-4-6-10-18(16)23)13-15-7-3-5-9-17(15)22/h3-10,19-20,24H,2,11-14H2,1H3 |
| InChIKey | VXMAXXJFUWSADU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |