C12H9BrF2N2O2 — CID 67738554
2-[(3-bromophenyl)methyl]-4-(difluoromethoxy)pyridazin-3-one (PubChem CID 67738554) has the molecular formula C12H9BrF2N2O2 and a molecular weight of 331.12 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl]-4-(difluoromethoxy)pyridazin-3-one.
| Compound Name | 2-[(3-bromophenyl)methyl]-4-(difluoromethoxy)pyridazin-3-one |
|---|---|
| PubChem CID | 67738554 |
| Molecular Formula | C12H9BrF2N2O2 |
| Molecular Weight | 331.12 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | 2-[(3-bromophenyl)methyl]-4-(difluoromethoxy)pyridazin-3-one |
| SMILES | O=c1c(OC(F)F)ccnn1Cc1cccc(Br)c1 |
| InChI | InChI=1S/C12H9BrF2N2O2/c13-9-3-1-2-8(6-9)7-17-11(18)10(4-5-16-17)19-12(14)15/h1-6,12H,7H2 |
| InChIKey | RRPDALZGSRGDPW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.12 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |