About (5-bromo-3-pyridinyl)-[6-[4-(3,3-dimethylbutyl)-1,4-diazepan-1-yl]-2-pyridinyl]methanone
(5-bromo-3-pyridinyl)-[6-[4-(3,3-dimethylbutyl)-1,4-diazepan-1-yl]-2-pyridinyl]methanone (PubChem CID 67738912) has the molecular formula C22H29BrN4O
and a molecular weight of 445.41 g/mol. Its IUPAC name is (5-bromo-3-pyridinyl)-[6-[4-(3,3-dimethylbutyl)-1,4-diazepan-1-yl]-2-pyridinyl]methanone.
Molecular Properties
| Compound Name | (5-bromo-3-pyridinyl)-[6-[4-(3,3-dimethylbutyl)-1,4-diazepan-1-yl]-2-pyridinyl]methanone |
| PubChem CID | 67738912 |
| Molecular Formula | C22H29BrN4O |
| Molecular Weight | 445.41 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | (5-bromo-3-pyridinyl)-[6-[4-(3,3-dimethylbutyl)-1,4-diazepan-1-yl]-2-pyridinyl]methanone |
| SMILES | CC(C)(C)CCN1CCCN(c2cccc(C(=O)c3cncc(Br)c3)n2)CC1 |
| InChI | InChI=1S/C22H29BrN4O/c1-22(2,3)8-11-26-9-5-10-27(13-12-26)20-7-4-6-19(25-20)21(28)17-14-18(23)16-24-15-17/h4,6-7,14-16H,5,8-13H2,1-3H3 |
| InChIKey | HMZCUJXUAIIGTF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-bromo-3-pyridinyl)-[6-[4-(3,3-dimethylbutyl)-1,4-diazepan-1-yl]-2-pyridinyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromo-3-pyridinyl)-[6-[4-(3,3-dimethylbutyl)-1,4-diazepan-1-yl]-2-pyridinyl]methanone?
The IUPAC name of (5-bromo-3-pyridinyl)-[6-[4-(3,3-dimethylbutyl)-1,4-diazepan-1-yl]-2-pyridinyl]methanone (CID 67738912) is (5-bromo-3-pyridinyl)-[6-[4-(3,3-dimethylbutyl)-1,4-diazepan-1-yl]-2-pyridinyl]methanone.
What is the SMILES notation for (5-bromo-3-pyridinyl)-[6-[4-(3,3-dimethylbutyl)-1,4-diazepan-1-yl]-2-pyridinyl]methanone?
The canonical SMILES for (5-bromo-3-pyridinyl)-[6-[4-(3,3-dimethylbutyl)-1,4-diazepan-1-yl]-2-pyridinyl]methanone is CC(C)(C)CCN1CCCN(c2cccc(C(=O)c3cncc(Br)c3)n2)CC1.
What is the InChIKey of (5-bromo-3-pyridinyl)-[6-[4-(3,3-dimethylbutyl)-1,4-diazepan-1-yl]-2-pyridinyl]methanone?
The InChIKey is HMZCUJXUAIIGTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29BrN4O/c1-22(2,3)8-11-26-9-5-10-27(13-12-26)20-7-4-6-19(25-20)21(28)17-14-18(23)16-24-15-17/h4,6-7,14-16H,5,8-13H2,1-3H3.
What are the key properties of (5-bromo-3-pyridinyl)-[6-[4-(3,3-dimethylbutyl)-1,4-diazepan-1-yl]-2-pyridinyl]methanone?
(5-bromo-3-pyridinyl)-[6-[4-(3,3-dimethylbutyl)-1,4-diazepan-1-yl]-2-pyridinyl]methanone has a molecular weight of 445.41 g/mol, XLogP of 4.42, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromo-3-pyridinyl)-[6-[4-(3,3-dimethylbutyl)-1,4-diazepan-1-yl]-2-pyridinyl]methanone is sourced from PubChem (CID 67738912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).