C27H28N2O — CID 67744575
(S)-pyridin-2-yl-[1-(1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenylmethyl)piperidin-4-yl]methanol (PubChem CID 67744575) has the molecular formula C27H28N2O and a molecular weight of 396.53 g/mol. Its IUPAC name is (S)-pyridin-2-yl-[1-(1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenylmethyl)piperidin-4-yl]methanol.
| Compound Name | (S)-pyridin-2-yl-[1-(1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenylmethyl)piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 67744575 |
| Molecular Formula | C27H28N2O |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | (S)-pyridin-2-yl-[1-(1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenylmethyl)piperidin-4-yl]methanol |
| SMILES | O[C@H](c1ccccn1)C1CCN(CC23CC(c4ccccc42)c2ccccc23)CC1 |
| InChI | InChI=1S/C27H28N2O/c30-26(25-11-5-6-14-28-25)19-12-15-29(16-13-19)18-27-17-22(20-7-1-3-9-23(20)27)21-8-2-4-10-24(21)27/h1-11,14,19,22,26,30H,12-13,15-18H2/t22?,26-,27?/m0/s1 |
| InChIKey | TXHHVHZBNMTCJE-WHIIENQPSA-N |
| XLogP | 4.66 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |