C30H31N3O — CID 67751592
(S)-(1-methylbenzimidazol-2-yl)-[1-(1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenylmethyl)piperidin-4-yl]methanol (PubChem CID 67751592) has the molecular formula C30H31N3O and a molecular weight of 449.60 g/mol. Its IUPAC name is (S)-(1-methylbenzimidazol-2-yl)-[1-(1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenylmethyl)piperidin-4-yl]methanol.
| Compound Name | (S)-(1-methylbenzimidazol-2-yl)-[1-(1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenylmethyl)piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 67751592 |
| Molecular Formula | C30H31N3O |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | (S)-(1-methylbenzimidazol-2-yl)-[1-(1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenylmethyl)piperidin-4-yl]methanol |
| SMILES | Cn1c([C@@H](O)C2CCN(CC34CC(c5ccccc53)c3ccccc34)CC2)nc2ccccc21 |
| InChI | InChI=1S/C30H31N3O/c1-32-27-13-7-6-12-26(27)31-29(32)28(34)20-14-16-33(17-15-20)19-30-18-23(21-8-2-4-10-24(21)30)22-9-3-5-11-25(22)30/h2-13,20,23,28,34H,14-19H2,1H3/t23?,28-,30?/m0/s1 |
| InChIKey | SSFWCGXKSDCCLI-IGIYDSRNSA-N |
| XLogP | 5.15 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |