C13H16Cl2O3 — CID 67745644
3,3-dichloro-2-ethyl-2-(hydroxymethyl)-4-phenylbutanoic acid (PubChem CID 67745644) has the molecular formula C13H16Cl2O3 and a molecular weight of 291.17 g/mol. Its IUPAC name is 3,3-dichloro-2-ethyl-2-(hydroxymethyl)-4-phenylbutanoic acid.
| Compound Name | 3,3-dichloro-2-ethyl-2-(hydroxymethyl)-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 67745644 |
| Molecular Formula | C13H16Cl2O3 |
| Molecular Weight | 291.17 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 3,3-dichloro-2-ethyl-2-(hydroxymethyl)-4-phenylbutanoic acid |
| SMILES | CCC(CO)(C(=O)O)C(Cl)(Cl)Cc1ccccc1 |
| InChI | InChI=1S/C13H16Cl2O3/c1-2-12(9-16,11(17)18)13(14,15)8-10-6-4-3-5-7-10/h3-7,16H,2,8-9H2,1H3,(H,17,18) |
| InChIKey | GMCOPAJAJHMJSL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.17 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|