C16H29N3 — CID 67748631
1-N,1-N,1-N',1-N'-tetraethyl-2-N-phenylethane-1,1,2-triamine (PubChem CID 67748631) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is 1-N,1-N,1-N',1-N'-tetraethyl-2-N-phenylethane-1,1,2-triamine.
| Compound Name | 1-N,1-N,1-N',1-N'-tetraethyl-2-N-phenylethane-1,1,2-triamine |
|---|---|
| PubChem CID | 67748631 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | 1-N,1-N,1-N',1-N'-tetraethyl-2-N-phenylethane-1,1,2-triamine |
| SMILES | CCN(CC)C(CNc1ccccc1)N(CC)CC |
| InChI | InChI=1S/C16H29N3/c1-5-18(6-2)16(19(7-3)8-4)14-17-15-12-10-9-11-13-15/h9-13,16-17H,5-8,14H2,1-4H3 |
| InChIKey | CIKBCHJIKZLZAO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|