C22H38O8 — CID 67751811
(4R,5R,6S,7R,8S,10R,12R,13R,14S)-5,13,14-trihydroxy-7,8-dimethoxy-4,6,8,10,12,15-hexamethyl-2-oxabicyclo[12.1.0]pentadecane-3,11-dione (PubChem CID 67751811) has the molecular formula C22H38O8 and a molecular weight of 430.54 g/mol. Its IUPAC name is (4R,5R,6S,7R,8S,10R,12R,13R,14S)-5,13,14-trihydroxy-7,8-dimethoxy-4,6,8,10,12,15-hexamethyl-2-oxabicyclo[12.1.0]pentadecane-3,11-dione.
| Compound Name | (4R,5R,6S,7R,8S,10R,12R,13R,14S)-5,13,14-trihydroxy-7,8-dimethoxy-4,6,8,10,12,15-hexamethyl-2-oxabicyclo[12.1.0]pentadecane-3,11-dione |
|---|---|
| PubChem CID | 67751811 |
| Molecular Formula | C22H38O8 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | (4R,5R,6S,7R,8S,10R,12R,13R,14S)-5,13,14-trihydroxy-7,8-dimethoxy-4,6,8,10,12,15-hexamethyl-2-oxabicyclo[12.1.0]pentadecane-3,11-dione |
| SMILES | CO[C@@H]1[C@@H](C)[C@@H](O)[C@@H](C)C(=O)OC2C(C)[C@]2(O)[C@H](O)[C@@H](C)C(=O)[C@H](C)C[C@]1(C)OC |
| InChI | InChI=1S/C22H38O8/c1-10-9-21(6,29-8)18(28-7)12(3)16(24)13(4)20(26)30-19-14(5)22(19,27)17(25)11(2)15(10)23/h10-14,16-19,24-25,27H,9H2,1-8H3/t10-,11+,12+,13-,14?,16-,17-,18-,19?,21+,22+/m1/s1 |
| InChIKey | WTVJERMJDMDUEJ-CUGNMSQKSA-N |
| XLogP | 0.94 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |