C16H24O5 — CID 162853208
(1S,2R,5R,6S,9R,10S,12S,13S)-12-hydroxy-9-methoxy-5,9,13-trimethyl-3,14-dioxatetracyclo[8.4.0.01,13.02,6]tetradecan-4-one (PubChem CID 162853208) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is (1S,2R,5R,6S,9R,10S,12S,13S)-12-hydroxy-9-methoxy-5,9,13-trimethyl-3,14-dioxatetracyclo[8.4.0.01,13.02,6]tetradecan-4-one.
| Compound Name | (1S,2R,5R,6S,9R,10S,12S,13S)-12-hydroxy-9-methoxy-5,9,13-trimethyl-3,14-dioxatetracyclo[8.4.0.01,13.02,6]tetradecan-4-one |
|---|---|
| PubChem CID | 162853208 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (1S,2R,5R,6S,9R,10S,12S,13S)-12-hydroxy-9-methoxy-5,9,13-trimethyl-3,14-dioxatetracyclo[8.4.0.01,13.02,6]tetradecan-4-one |
| SMILES | CO[C@]1(C)CC[C@@H]2[C@@H](OC(=O)[C@@H]2C)[C@]23O[C@@]2(C)[C@@H](O)C[C@H]31 |
| InChI | InChI=1S/C16H24O5/c1-8-9-5-6-14(2,19-4)10-7-11(17)15(3)16(10,21-15)12(9)20-13(8)18/h8-12,17H,5-7H2,1-4H3/t8-,9+,10+,11+,12-,14-,15+,16+/m1/s1 |
| InChIKey | QXNDKOLAXZTWBH-IAZUCRSISA-N |
| XLogP | 1.27 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|