C25H26N2O2S — CID 67753440
2-benzofuran-1-yl-[2-methoxy-5-[5-(pyrrolidin-1-ylmethyl)thiophen-2-yl]phenyl]methanamine (PubChem CID 67753440) has the molecular formula C25H26N2O2S and a molecular weight of 418.56 g/mol. Its IUPAC name is 2-benzofuran-1-yl-[2-methoxy-5-[5-(pyrrolidin-1-ylmethyl)thiophen-2-yl]phenyl]methanamine.
| Compound Name | 2-benzofuran-1-yl-[2-methoxy-5-[5-(pyrrolidin-1-ylmethyl)thiophen-2-yl]phenyl]methanamine |
|---|---|
| PubChem CID | 67753440 |
| Molecular Formula | C25H26N2O2S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 2-benzofuran-1-yl-[2-methoxy-5-[5-(pyrrolidin-1-ylmethyl)thiophen-2-yl]phenyl]methanamine |
| SMILES | COc1ccc(-c2ccc(CN3CCCC3)s2)cc1C(N)c1occ2ccccc12 |
| InChI | InChI=1S/C25H26N2O2S/c1-28-22-10-8-17(23-11-9-19(30-23)15-27-12-4-5-13-27)14-21(22)24(26)25-20-7-3-2-6-18(20)16-29-25/h2-3,6-11,14,16,24H,4-5,12-13,15,26H2,1H3 |
| InChIKey | LBTITZPYVOOOKH-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 51.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |