C44H54N8O5 — CID 67751731
bis(1-(2-benzofuran-1-yl)-1-[2-methoxy-5-(pyrrolidin-1-ylmethyl)phenyl]-2-methylguanidine);hydrate (PubChem CID 67751731) has the molecular formula C44H54N8O5 and a molecular weight of 774.97 g/mol. Its IUPAC name is bis(1-(2-benzofuran-1-yl)-1-[2-methoxy-5-(pyrrolidin-1-ylmethyl)phenyl]-2-methylguanidine);hydrate.
| Compound Name | bis(1-(2-benzofuran-1-yl)-1-[2-methoxy-5-(pyrrolidin-1-ylmethyl)phenyl]-2-methylguanidine);hydrate |
|---|---|
| PubChem CID | 67751731 |
| Molecular Formula | C44H54N8O5 |
| Molecular Weight | 774.97 g/mol |
| Exact Mass | 774.42 |
| IUPAC Name | bis(1-(2-benzofuran-1-yl)-1-[2-methoxy-5-(pyrrolidin-1-ylmethyl)phenyl]-2-methylguanidine);hydrate |
| SMILES | C/N=C(\N)N(c1cc(CN2CCCC2)ccc1OC)c1occ2ccccc12.C/N=C(\N)N(c1cc(CN2CCCC2)ccc1OC)c1occ2ccccc12.O |
| InChI | InChI=1S/2C22H26N4O2.H2O/c2*1-24-22(23)26(21-18-8-4-3-7-17(18)15-28-21)19-13-16(9-10-20(19)27-2)14-25-11-5-6-12-25;/h2*3-4,7-10,13,15H,5-6,11-12,14H2,1-2H3,(H2,23,24);1H2 |
| InChIKey | CFLCODSAPJRZDI-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 165.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.97 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|