C27H36N4O2 — CID 67751677
1-(2-benzofuran-1-yl)-1-[2-methoxy-5-[4-(4-methylpiperidin-1-yl)butyl]phenyl]-2-methylguanidine (PubChem CID 67751677) has the molecular formula C27H36N4O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is 1-(2-benzofuran-1-yl)-1-[2-methoxy-5-[4-(4-methylpiperidin-1-yl)butyl]phenyl]-2-methylguanidine.
| Compound Name | 1-(2-benzofuran-1-yl)-1-[2-methoxy-5-[4-(4-methylpiperidin-1-yl)butyl]phenyl]-2-methylguanidine |
|---|---|
| PubChem CID | 67751677 |
| Molecular Formula | C27H36N4O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | 1-(2-benzofuran-1-yl)-1-[2-methoxy-5-[4-(4-methylpiperidin-1-yl)butyl]phenyl]-2-methylguanidine |
| SMILES | C/N=C(\N)N(c1cc(CCCCN2CCC(C)CC2)ccc1OC)c1occ2ccccc12 |
| InChI | InChI=1S/C27H36N4O2/c1-20-13-16-30(17-14-20)15-7-6-8-21-11-12-25(32-3)24(18-21)31(27(28)29-2)26-23-10-5-4-9-22(23)19-33-26/h4-5,9-12,18-20H,6-8,13-17H2,1-3H3,(H2,28,29) |
| InChIKey | QZBSSQDOYLEATD-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|