C25H34N4O4 — CID 67751623
1-(2-benzofuran-1-yl)-1-[2-methoxy-5-(4-morpholin-4-ylbutyl)phenyl]-2-methylguanidine;hydrate (PubChem CID 67751623) has the molecular formula C25H34N4O4 and a molecular weight of 454.57 g/mol. Its IUPAC name is 1-(2-benzofuran-1-yl)-1-[2-methoxy-5-(4-morpholin-4-ylbutyl)phenyl]-2-methylguanidine;hydrate.
| Compound Name | 1-(2-benzofuran-1-yl)-1-[2-methoxy-5-(4-morpholin-4-ylbutyl)phenyl]-2-methylguanidine;hydrate |
|---|---|
| PubChem CID | 67751623 |
| Molecular Formula | C25H34N4O4 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | 1-(2-benzofuran-1-yl)-1-[2-methoxy-5-(4-morpholin-4-ylbutyl)phenyl]-2-methylguanidine;hydrate |
| SMILES | C/N=C(\N)N(c1cc(CCCCN2CCOCC2)ccc1OC)c1occ2ccccc12.O |
| InChI | InChI=1S/C25H32N4O3.H2O/c1-27-25(26)29(24-21-9-4-3-8-20(21)18-32-24)22-17-19(10-11-23(22)30-2)7-5-6-12-28-13-15-31-16-14-28;/h3-4,8-11,17-18H,5-7,12-16H2,1-2H3,(H2,26,27);1H2 |
| InChIKey | OGJLLZLRFTXOPJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 107.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|