C24H30N4O2 — CID 67752081
1-(2-benzofuran-1-yl)-1-[2-methoxy-5-(2-pyrrolidin-1-ylpropyl)phenyl]-2-methylguanidine (PubChem CID 67752081) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 1-(2-benzofuran-1-yl)-1-[2-methoxy-5-(2-pyrrolidin-1-ylpropyl)phenyl]-2-methylguanidine.
| Compound Name | 1-(2-benzofuran-1-yl)-1-[2-methoxy-5-(2-pyrrolidin-1-ylpropyl)phenyl]-2-methylguanidine |
|---|---|
| PubChem CID | 67752081 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 1-(2-benzofuran-1-yl)-1-[2-methoxy-5-(2-pyrrolidin-1-ylpropyl)phenyl]-2-methylguanidine |
| SMILES | C/N=C(\N)N(c1cc(CC(C)N2CCCC2)ccc1OC)c1occ2ccccc12 |
| InChI | InChI=1S/C24H30N4O2/c1-17(27-12-6-7-13-27)14-18-10-11-22(29-3)21(15-18)28(24(25)26-2)23-20-9-5-4-8-19(20)16-30-23/h4-5,8-11,15-17H,6-7,12-14H2,1-3H3,(H2,25,26) |
| InChIKey | NDWDPLSVBHJVBT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|