C17H17NO3 — CID 67752154
N-(2,5-dimethoxyphenyl)-N-methyl-2-benzofuran-1-amine (PubChem CID 67752154) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-N-methyl-2-benzofuran-1-amine.
| Compound Name | N-(2,5-dimethoxyphenyl)-N-methyl-2-benzofuran-1-amine |
|---|---|
| PubChem CID | 67752154 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-N-methyl-2-benzofuran-1-amine |
| SMILES | COc1ccc(OC)c(N(C)c2occ3ccccc23)c1 |
| InChI | InChI=1S/C17H17NO3/c1-18(15-10-13(19-2)8-9-16(15)20-3)17-14-7-5-4-6-12(14)11-21-17/h4-11H,1-3H3 |
| InChIKey | YIBXBRPPGFDGRB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |