C10H14BrNO2 — CID 21117287
N-bromo-N-ethyl-2,5-dimethoxyaniline (PubChem CID 21117287) has the molecular formula C10H14BrNO2 and a molecular weight of 260.13 g/mol. Its IUPAC name is N-bromo-N-ethyl-2,5-dimethoxyaniline.
| Compound Name | N-bromo-N-ethyl-2,5-dimethoxyaniline |
|---|---|
| PubChem CID | 21117287 |
| Molecular Formula | C10H14BrNO2 |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | N-bromo-N-ethyl-2,5-dimethoxyaniline |
| SMILES | CCN(Br)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C10H14BrNO2/c1-4-12(11)9-7-8(13-2)5-6-10(9)14-3/h5-7H,4H2,1-3H3 |
| InChIKey | BICILUYJGSAQAE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|