C32H41N5O4 — CID 67751709
1-(2-benzofuran-1-yl)-1-[2-methoxy-5-[4-[4-(3-methoxyphenyl)piperazin-1-yl]butyl]phenyl]-2-methylguanidine;hydrate (PubChem CID 67751709) has the molecular formula C32H41N5O4 and a molecular weight of 559.71 g/mol. Its IUPAC name is 1-(2-benzofuran-1-yl)-1-[2-methoxy-5-[4-[4-(3-methoxyphenyl)piperazin-1-yl]butyl]phenyl]-2-methylguanidine;hydrate.
| Compound Name | 1-(2-benzofuran-1-yl)-1-[2-methoxy-5-[4-[4-(3-methoxyphenyl)piperazin-1-yl]butyl]phenyl]-2-methylguanidine;hydrate |
|---|---|
| PubChem CID | 67751709 |
| Molecular Formula | C32H41N5O4 |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.32 |
| IUPAC Name | 1-(2-benzofuran-1-yl)-1-[2-methoxy-5-[4-[4-(3-methoxyphenyl)piperazin-1-yl]butyl]phenyl]-2-methylguanidine;hydrate |
| SMILES | C/N=C(\N)N(c1cc(CCCCN2CCN(c3cccc(OC)c3)CC2)ccc1OC)c1occ2ccccc12.O |
| InChI | InChI=1S/C32H39N5O3.H2O/c1-34-32(33)37(31-28-13-5-4-10-25(28)23-40-31)29-21-24(14-15-30(29)39-3)9-6-7-16-35-17-19-36(20-18-35)26-11-8-12-27(22-26)38-2;/h4-5,8,10-15,21-23H,6-7,9,16-20H2,1-3H3,(H2,33,34);1H2 |
| InChIKey | PGFNHLOMSUNCPN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 111.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|