C24H26O3S — CID 67755432
4-hydroxy-6-(4-phenylbutyl)-3-(2-propan-2-ylphenyl)sulfanylpyran-2-one (PubChem CID 67755432) has the molecular formula C24H26O3S and a molecular weight of 394.54 g/mol. Its IUPAC name is 4-hydroxy-6-(4-phenylbutyl)-3-(2-propan-2-ylphenyl)sulfanylpyran-2-one.
| Compound Name | 4-hydroxy-6-(4-phenylbutyl)-3-(2-propan-2-ylphenyl)sulfanylpyran-2-one |
|---|---|
| PubChem CID | 67755432 |
| Molecular Formula | C24H26O3S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 4-hydroxy-6-(4-phenylbutyl)-3-(2-propan-2-ylphenyl)sulfanylpyran-2-one |
| SMILES | CC(C)c1ccccc1Sc1c(O)cc(CCCCc2ccccc2)oc1=O |
| InChI | InChI=1S/C24H26O3S/c1-17(2)20-14-8-9-15-22(20)28-23-21(25)16-19(27-24(23)26)13-7-6-12-18-10-4-3-5-11-18/h3-5,8-11,14-17,25H,6-7,12-13H2,1-2H3 |
| InChIKey | SUSZKYMTEDWVCB-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|