C21H20O3S — CID 70071089
4-hydroxy-6-(2-phenylethyl)-3-(2-phenylethylsulfanyl)pyran-2-one (PubChem CID 70071089) has the molecular formula C21H20O3S and a molecular weight of 352.45 g/mol. Its IUPAC name is 4-hydroxy-6-(2-phenylethyl)-3-(2-phenylethylsulfanyl)pyran-2-one.
| Compound Name | 4-hydroxy-6-(2-phenylethyl)-3-(2-phenylethylsulfanyl)pyran-2-one |
|---|---|
| PubChem CID | 70071089 |
| Molecular Formula | C21H20O3S |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 4-hydroxy-6-(2-phenylethyl)-3-(2-phenylethylsulfanyl)pyran-2-one |
| SMILES | O=c1oc(CCc2ccccc2)cc(O)c1SCCc1ccccc1 |
| InChI | InChI=1S/C21H20O3S/c22-19-15-18(12-11-16-7-3-1-4-8-16)24-21(23)20(19)25-14-13-17-9-5-2-6-10-17/h1-10,15,22H,11-14H2 |
| InChIKey | RVTYTDBLYQMGTJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |