C17H14O3 — CID 10890802
7-hydroxy-2-(2-phenylethyl)chromen-4-one (PubChem CID 10890802) has the molecular formula C17H14O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 7-hydroxy-2-(2-phenylethyl)chromen-4-one.
| Compound Name | 7-hydroxy-2-(2-phenylethyl)chromen-4-one |
|---|---|
| PubChem CID | 10890802 |
| Molecular Formula | C17H14O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 7-hydroxy-2-(2-phenylethyl)chromen-4-one |
| SMILES | O=c1cc(CCc2ccccc2)oc2cc(O)ccc12 |
| InChI | InChI=1S/C17H14O3/c18-13-7-9-15-16(19)11-14(20-17(15)10-13)8-6-12-4-2-1-3-5-12/h1-5,7,9-11,18H,6,8H2 |
| InChIKey | QVPPGYBSJQCGTN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |