C21H18N2O4 — CID 67757581
[11-(pyridin-3-ylmethylamino)-6,11-dihydrobenzo[c][1]benzoxepin-2-yl] hydrogen carbonate (PubChem CID 67757581) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is [11-(pyridin-3-ylmethylamino)-6,11-dihydrobenzo[c][1]benzoxepin-2-yl] hydrogen carbonate.
| Compound Name | [11-(pyridin-3-ylmethylamino)-6,11-dihydrobenzo[c][1]benzoxepin-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 67757581 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | [11-(pyridin-3-ylmethylamino)-6,11-dihydrobenzo[c][1]benzoxepin-2-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1ccc2c(c1)C(NCc1cccnc1)c1ccccc1CO2 |
| InChI | InChI=1S/C21H18N2O4/c24-21(25)27-16-7-8-19-18(10-16)20(23-12-14-4-3-9-22-11-14)17-6-2-1-5-15(17)13-26-19/h1-11,20,23H,12-13H2,(H,24,25) |
| InChIKey | DYMJBEGCOHVDLS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|