C29H31NO4S — CID 67833390
[11-[2-(4-benzylpiperidin-1-yl)ethylsulfanyl]-6,11-dihydrobenzo[c][1]benzoxepin-2-yl] hydrogen carbonate (PubChem CID 67833390) has the molecular formula C29H31NO4S and a molecular weight of 489.64 g/mol. Its IUPAC name is [11-[2-(4-benzylpiperidin-1-yl)ethylsulfanyl]-6,11-dihydrobenzo[c][1]benzoxepin-2-yl] hydrogen carbonate.
| Compound Name | [11-[2-(4-benzylpiperidin-1-yl)ethylsulfanyl]-6,11-dihydrobenzo[c][1]benzoxepin-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 67833390 |
| Molecular Formula | C29H31NO4S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | [11-[2-(4-benzylpiperidin-1-yl)ethylsulfanyl]-6,11-dihydrobenzo[c][1]benzoxepin-2-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1ccc2c(c1)C(SCCN1CCC(Cc3ccccc3)CC1)c1ccccc1CO2 |
| InChI | InChI=1S/C29H31NO4S/c31-29(32)34-24-10-11-27-26(19-24)28(25-9-5-4-8-23(25)20-33-27)35-17-16-30-14-12-22(13-15-30)18-21-6-2-1-3-7-21/h1-11,19,22,28H,12-18,20H2,(H,31,32) |
| InChIKey | XCJNSNYAGVPCRM-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|