C23H20BrNO6S2 — CID 67836338
[11-[2-(benzenesulfonamido)ethylsulfanyl]-9-bromo-6,11-dihydrobenzo[c][1]benzoxepin-2-yl] hydrogen carbonate (PubChem CID 67836338) has the molecular formula C23H20BrNO6S2 and a molecular weight of 550.45 g/mol. Its IUPAC name is [11-[2-(benzenesulfonamido)ethylsulfanyl]-9-bromo-6,11-dihydrobenzo[c][1]benzoxepin-2-yl] hydrogen carbonate.
| Compound Name | [11-[2-(benzenesulfonamido)ethylsulfanyl]-9-bromo-6,11-dihydrobenzo[c][1]benzoxepin-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 67836338 |
| Molecular Formula | C23H20BrNO6S2 |
| Molecular Weight | 550.45 g/mol |
| Exact Mass | 548.99 |
| IUPAC Name | [11-[2-(benzenesulfonamido)ethylsulfanyl]-9-bromo-6,11-dihydrobenzo[c][1]benzoxepin-2-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1ccc2c(c1)C(SCCNS(=O)(=O)c1ccccc1)c1cc(Br)ccc1CO2 |
| InChI | InChI=1S/C23H20BrNO6S2/c24-16-7-6-15-14-30-21-9-8-17(31-23(26)27)13-20(21)22(19(15)12-16)32-11-10-25-33(28,29)18-4-2-1-3-5-18/h1-9,12-13,22,25H,10-11,14H2,(H,26,27) |
| InChIKey | NULAVOSHKPZHKF-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.45 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|