C24H23NO4S2 — CID 10026942
2-[2-(benzenesulfonamido)ethylsulfanyl]tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene-5-carboxylic acid (PubChem CID 10026942) has the molecular formula C24H23NO4S2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 2-[2-(benzenesulfonamido)ethylsulfanyl]tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene-5-carboxylic acid.
| Compound Name | 2-[2-(benzenesulfonamido)ethylsulfanyl]tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene-5-carboxylic acid |
|---|---|
| PubChem CID | 10026942 |
| Molecular Formula | C24H23NO4S2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 2-[2-(benzenesulfonamido)ethylsulfanyl]tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(SCCNS(=O)(=O)c1ccccc1)c1ccccc1CC2 |
| InChI | InChI=1S/C24H23NO4S2/c26-24(27)19-13-12-18-11-10-17-6-4-5-9-21(17)23(22(18)16-19)30-15-14-25-31(28,29)20-7-2-1-3-8-20/h1-9,12-13,16,23,25H,10-11,14-15H2,(H,26,27) |
| InChIKey | QSQLLPCHAUUEJG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|