C26H25NO4S2 — CID 57279734
2-[2-(2-phenylethylsulfonylamino)ethenylsulfanyl]tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene-5-carboxylic acid (PubChem CID 57279734) has the molecular formula C26H25NO4S2 and a molecular weight of 479.62 g/mol. Its IUPAC name is 2-[2-(2-phenylethylsulfonylamino)ethenylsulfanyl]tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene-5-carboxylic acid.
| Compound Name | 2-[2-(2-phenylethylsulfonylamino)ethenylsulfanyl]tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene-5-carboxylic acid |
|---|---|
| PubChem CID | 57279734 |
| Molecular Formula | C26H25NO4S2 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 2-[2-(2-phenylethylsulfonylamino)ethenylsulfanyl]tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(SC=CNS(=O)(=O)CCc1ccccc1)c1ccccc1CC2 |
| InChI | InChI=1S/C26H25NO4S2/c28-26(29)22-13-12-21-11-10-20-8-4-5-9-23(20)25(24(21)18-22)32-16-15-27-33(30,31)17-14-19-6-2-1-3-7-19/h1-9,12-13,15-16,18,25,27H,10-11,14,17H2,(H,28,29) |
| InChIKey | JHULLGZOQIVVAV-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |