C17H19NO3S — CID 110751566
N-(3,4-dihydro-2H-chromen-3-yl)-2-phenylethanesulfonamide (PubChem CID 110751566) has the molecular formula C17H19NO3S and a molecular weight of 317.41 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-chromen-3-yl)-2-phenylethanesulfonamide.
| Compound Name | N-(3,4-dihydro-2H-chromen-3-yl)-2-phenylethanesulfonamide |
|---|---|
| PubChem CID | 110751566 |
| Molecular Formula | C17H19NO3S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | N-(3,4-dihydro-2H-chromen-3-yl)-2-phenylethanesulfonamide |
| SMILES | O=S(=O)(CCc1ccccc1)NC1COc2ccccc2C1 |
| InChI | InChI=1S/C17H19NO3S/c19-22(20,11-10-14-6-2-1-3-7-14)18-16-12-15-8-4-5-9-17(15)21-13-16/h1-9,16,18H,10-13H2 |
| InChIKey | NWDIBETYUGBCKH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |