C26H25NO5S2 — CID 67835525
[2-[2-(2-phenylethenylsulfonylamino)ethylsulfanyl]-5-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl] hydrogen carbonate (PubChem CID 67835525) has the molecular formula C26H25NO5S2 and a molecular weight of 495.62 g/mol. Its IUPAC name is [2-[2-(2-phenylethenylsulfonylamino)ethylsulfanyl]-5-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl] hydrogen carbonate.
| Compound Name | [2-[2-(2-phenylethenylsulfonylamino)ethylsulfanyl]-5-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 67835525 |
| Molecular Formula | C26H25NO5S2 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | [2-[2-(2-phenylethenylsulfonylamino)ethylsulfanyl]-5-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl] hydrogen carbonate |
| SMILES | O=C(O)Oc1ccc2c(c1)C(SCCNS(=O)(=O)C=Cc1ccccc1)c1ccccc1CC2 |
| InChI | InChI=1S/C26H25NO5S2/c28-26(29)32-22-13-12-21-11-10-20-8-4-5-9-23(20)25(24(21)18-22)33-16-15-27-34(30,31)17-14-19-6-2-1-3-7-19/h1-9,12-14,17-18,25,27H,10-11,15-16H2,(H,28,29) |
| InChIKey | IKSRNDBECDITGY-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|