C25H25NO4S2 — CID 15026788
methyl 2-[2-(benzenesulfonamido)ethylsulfanyl]tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene-5-carboxylate (PubChem CID 15026788) has the molecular formula C25H25NO4S2 and a molecular weight of 467.61 g/mol. Its IUPAC name is methyl 2-[2-(benzenesulfonamido)ethylsulfanyl]tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene-5-carboxylate.
| Compound Name | methyl 2-[2-(benzenesulfonamido)ethylsulfanyl]tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene-5-carboxylate |
|---|---|
| PubChem CID | 15026788 |
| Molecular Formula | C25H25NO4S2 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | methyl 2-[2-(benzenesulfonamido)ethylsulfanyl]tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C(SCCNS(=O)(=O)c1ccccc1)c1ccccc1CC2 |
| InChI | InChI=1S/C25H25NO4S2/c1-30-25(27)20-14-13-19-12-11-18-7-5-6-10-22(18)24(23(19)17-20)31-16-15-26-32(28,29)21-8-3-2-4-9-21/h2-10,13-14,17,24,26H,11-12,15-16H2,1H3 |
| InChIKey | XIFIHYQHJCFFHI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|