C19H19NO2S — CID 10042003
methyl 2-(2-aminoethylsulfanyl)tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaene-5-carboxylate (PubChem CID 10042003) has the molecular formula C19H19NO2S and a molecular weight of 325.43 g/mol. Its IUPAC name is methyl 2-(2-aminoethylsulfanyl)tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaene-5-carboxylate.
| Compound Name | methyl 2-(2-aminoethylsulfanyl)tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaene-5-carboxylate |
|---|---|
| PubChem CID | 10042003 |
| Molecular Formula | C19H19NO2S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | methyl 2-(2-aminoethylsulfanyl)tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaene-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C(SCCN)c1ccccc1C=C2 |
| InChI | InChI=1S/C19H19NO2S/c1-22-19(21)15-9-8-14-7-6-13-4-2-3-5-16(13)18(17(14)12-15)23-11-10-20/h2-9,12,18H,10-11,20H2,1H3 |
| InChIKey | QUNNLYAUDFPNGJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|