C21H19NO5 — CID 163918965
methyl (1E)-3-(2-aminoacetyl)-1-[methoxy(phenyl)methylidene]-2-oxo-3H-indene-5-carboxylate (PubChem CID 163918965) has the molecular formula C21H19NO5 and a molecular weight of 365.39 g/mol. Its IUPAC name is methyl (1E)-3-(2-aminoacetyl)-1-[methoxy(phenyl)methylidene]-2-oxo-3H-indene-5-carboxylate.
| Compound Name | methyl (1E)-3-(2-aminoacetyl)-1-[methoxy(phenyl)methylidene]-2-oxo-3H-indene-5-carboxylate |
|---|---|
| PubChem CID | 163918965 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | methyl (1E)-3-(2-aminoacetyl)-1-[methoxy(phenyl)methylidene]-2-oxo-3H-indene-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C(C(=O)CN)C(=O)/C2=C(/OC)c1ccccc1 |
| InChI | InChI=1S/C21H19NO5/c1-26-20(12-6-4-3-5-7-12)18-14-9-8-13(21(25)27-2)10-15(14)17(19(18)24)16(23)11-22/h3-10,17H,11,22H2,1-2H3/b20-18+ |
| InChIKey | QYTBIOSIHQLHRN-CZIZESTLSA-N |
| XLogP | 2.18 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|