C17H17ClN2O4S — CID 175270949
(3R)-3-[[2-[(chloroamino)methyl]phenyl]sulfonylamino]-2,3-dihydro-1H-indene-5-carboxylic acid (PubChem CID 175270949) has the molecular formula C17H17ClN2O4S and a molecular weight of 380.85 g/mol. Its IUPAC name is (3R)-3-[[2-[(chloroamino)methyl]phenyl]sulfonylamino]-2,3-dihydro-1H-indene-5-carboxylic acid.
| Compound Name | (3R)-3-[[2-[(chloroamino)methyl]phenyl]sulfonylamino]-2,3-dihydro-1H-indene-5-carboxylic acid |
|---|---|
| PubChem CID | 175270949 |
| Molecular Formula | C17H17ClN2O4S |
| Molecular Weight | 380.85 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | (3R)-3-[[2-[(chloroamino)methyl]phenyl]sulfonylamino]-2,3-dihydro-1H-indene-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)[C@H](NS(=O)(=O)c1ccccc1CNCl)CC2 |
| InChI | InChI=1S/C17H17ClN2O4S/c18-19-10-13-3-1-2-4-16(13)25(23,24)20-15-8-7-11-5-6-12(17(21)22)9-14(11)15/h1-6,9,15,19-20H,7-8,10H2,(H,21,22)/t15-/m1/s1 |
| InChIKey | HZDKISOOQSHXFX-OAHLLOKOSA-N |
| XLogP | 2.59 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.85 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|