C19H20N2O4 — CID 67761005
1-[(4-amino-2-phenylphenyl)methyl]pyrrolidine-2,4-dicarboxylic acid (PubChem CID 67761005) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 1-[(4-amino-2-phenylphenyl)methyl]pyrrolidine-2,4-dicarboxylic acid.
| Compound Name | 1-[(4-amino-2-phenylphenyl)methyl]pyrrolidine-2,4-dicarboxylic acid |
|---|---|
| PubChem CID | 67761005 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 1-[(4-amino-2-phenylphenyl)methyl]pyrrolidine-2,4-dicarboxylic acid |
| SMILES | Nc1ccc(CN2CC(C(=O)O)CC2C(=O)O)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C19H20N2O4/c20-15-7-6-13(16(9-15)12-4-2-1-3-5-12)10-21-11-14(18(22)23)8-17(21)19(24)25/h1-7,9,14,17H,8,10-11,20H2,(H,22,23)(H,24,25) |
| InChIKey | FCXNVYZNGLALJP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|